Oxirane, 2-methyl-, polymer with oxirane, mono(2-propylheptyl) ether manufacturers
- Plurafac LF 901
-
-
2025-06-27
- CAS:166736-08-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | Oxirane, 2-methyl-, polymer with oxirane, mono(2-propylheptyl) ether Basic information |
| | Oxirane, 2-methyl-, polymer with oxirane, mono(2-propylheptyl) ether Chemical Properties |
| Cosmetics Ingredients Functions | SURFACTANT - CLEANSING
SURFACTANT - EMULSIFYING
CLEANSING | | Cosmetic Ingredient Review (CIR) | Oxirane, 2-methyl-, polymer with oxirane, mono(2-propylheptyl) ether (166736-08-9) | | InChI | InChI=1S/C10H22O.C3H6O.C2H4O/c1-3-5-6-8-10(9-11)7-4-2;1-3-2-4-3;1-2-3-1/h10-11H,3-9H2,1-2H3;3H,2H2,1H3;1-2H2 | | InChIKey | NELDGOLMOICKDQ-UHFFFAOYSA-N | | SMILES | C(CO)(CCC)CCCCC.C1OC1.CC1OC1 | | EPA Substance Registry System | Oxirane, methyl-, polymer with oxirane, mono(2-propylheptyl) ether (166736-08-9) |
| | Oxirane, 2-methyl-, polymer with oxirane, mono(2-propylheptyl) ether Usage And Synthesis |
| Description | PEG/PPG-8/2 Propylheptyl Ether is the product formed by the reaction of 2-propylheptanol with and average of 8 moles of ethylene oxide and 2 moles of propylene oxide |
| | Oxirane, 2-methyl-, polymer with oxirane, mono(2-propylheptyl) ether Preparation Products And Raw materials |
|