| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | [(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride Basic information | | Uses Reaction |
| Product Name: | [(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride | | Synonyms: | [(S)-(+)-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYL]PALLADIUM(II)CHLORIDE;PALLADIUM, [(1S)-[1,1''-BINAPHTHALENE]-2,2''-DIYLBIS[DIPHENYLPHOSPHINE-.KAPPA.P]]DICHLORO-, (SP-4-2)-;REF DUPL: [(S)-(-)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium (II) chloride;Dichloro[(S)-(-)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II), min. 98%;Dichloro[(S)-(-)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]palladiuM(II),Min.98%;Dichloro[(S)-(-)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]palladiuM(II),98% (S-BINAP)PdCl2;2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYLPALLADIUM(II) CHLORIDE;[(S)-(+)-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYL]PALLADIUM(II) | | CAS: | 127593-28-6 | | MF: | C44H34Cl2P2Pd | | MW: | 802.02 | | EINECS: | 631-388-5 | | Product Categories: | Pd | | Mol File: | 127593-28-6.mol | ![[(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride Structure](CAS/GIF/127593-28-6.gif) |
| | [(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride Chemical Properties |
| Melting point | >300°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Light yellow to yellow Solid | | InChIKey | VDHAUMFISVWIRX-UHFFFAOYSA-L | | SMILES | [Cl-][Pd+2]1(P(C2C=CC=CC=2)(C2C=CC=CC=2)C2C=CC3=CC=CC=C3C=2C2C3=CC=CC=C3C=CC=2P1(C1C=CC=CC=1)C1C=CC=CC=1)[Cl-] | | CAS DataBase Reference | 127593-28-6 |
| | [(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride Usage And Synthesis |
| Uses | [(S)-(-)-2,2-bis(diphenylphosphine)-1,1-binaphthyl]palladium dichloride is an organometallic derivative that can be used as a noble metal catalyst. | | Reaction |
- Catalyst precursor, with AgBF4 , for the enantioselective addition of silyl ethers, to imines to produce β-amino ketones, and to aldehydes to produce 3-hydroxy-1-propanone aldol addition products.
- Catalyst precursor, with AgSbF6, for the asymmetric carbonyl-ene reaction.
- Catalyst precursor for hetero Diels-Alder reaction of simple dienes with aldehydes and aryl glyoxals.
|
| | [(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride Preparation Products And Raw materials |
|