5,10-Methylene-THF manufacturers
- Arfolitixorin
-
- $2500.00 / 100mg
-
2025-08-21
- CAS:31690-11-6
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | 5,10-Methylene-THF Basic information |
| Product Name: | 5,10-Methylene-THF | | Synonyms: | 5,10-Methylene-THF;(6R) 5,10-Methylenetetrahydrofolate;5,10-Methylene-THF//
(S)-2-(4-((R)-3-Amino-1-oxo-5,6,6a,7-tetrahydro imidazo[1,5-f]pteridin-8(1H,4H,9H)-yl)benzami do)pentanedioic acid;N5,N10-Methylene-5,6,7,8-tetrahydrofolate;(S)-2-(4-((R)-3-amino-1-oxo;(S)-2-(4-((R)-3-Amino-1-oxo-5,6,6a,7-tetrahydroimidazo[1,5-f]pteridin-8(1H,4H,9H)-yl)benzamido)pentanedioic acid;L-Glutamic acid, N-[4-[(6aR)-3-amino-1,2,5,6,6a,7-hexahydro-1-oxoimidazo[1,5-f]pteridin-8(9H)-yl]benzoyl]-;Folinic Acid EP Impurity I | | CAS: | 31690-11-6 | | MF: | C20H23N7O6 | | MW: | 457.44 | | EINECS: | | | Product Categories: | | | Mol File: | 31690-11-6.mol |  |
| | 5,10-Methylene-THF Chemical Properties |
| density | 1.75±0.1 g/cm3(Predicted) | | pKa | 3.47±0.10(Predicted) | | InChIKey | QYNUQALWYRSVHF-OLZOCXBDSA-N | | SMILES | C(O)(=O)[C@H](CCC(O)=O)NC(=O)C1=CC=C(N2C[C@@]3([H])CNC4=C(N3C2)C(=O)NC(N)=N4)C=C1 |
| | 5,10-Methylene-THF Usage And Synthesis |
| Uses | Arfolitixorin is a folate prodrug that is used in the treatment for colorectal cancer as a way for increase in efficacy and reducing the side effects of antimetabolites used in cancer treatment. | | Definition | ChEBI: (6R)-5,10-methylenetetrahydrofolic acid is the (6R)-stereoisomer of 5,10-methylenetetrahydrofolic acid. It has a role as an Escherichia coli metabolite, a mouse metabolite and a cofactor. It is a conjugate acid of a (6R)-5,10-methylenetetrahydrofolate(2-). |
| | 5,10-Methylene-THF Preparation Products And Raw materials |
|