|
|
| | BENZYLHYDRAZINE DIHYDROCHLORIDE Basic information |
| | BENZYLHYDRAZINE DIHYDROCHLORIDE Chemical Properties |
| Melting point | 143-145 °C (dec.)(lit.) | | Boiling point | 149.5℃ at 95.5kPa | | density | 0.628g/cm3 at 23℃ | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | Slightly yellow to beige | | Water Solubility | Insoluble in water. | | BRN | 3688990 | | InChI | InChI=1S/C7H10N2.2ClH/c8-9-6-7-4-2-1-3-5-7;;/h1-5,9H,6,8H2;2*1H | | InChIKey | MSJHOJKVMMEMNX-UHFFFAOYSA-N | | SMILES | N(CC1=CC=CC=C1)N.[H]Cl.[H]Cl | | Dissociation constant | 0.001-0.001 at 23℃ | | CAS DataBase Reference | 20570-96-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | MU8540000 | | F | 10 | | TSCA | Yes | | HazardClass | 6.1 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 29280000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 | | Toxicity | LD50 ipr-mus: 11 mg/kg JMCMAR 18,20,75 |
| | BENZYLHYDRAZINE DIHYDROCHLORIDE Usage And Synthesis |
| Chemical Properties | slightly yellow to beige powder | | Uses | Benzylhydrazine dihydrochloride is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields. | | Safety Profile | Poison by intraperitoneal route.Questionable carcinogen with experimental neoplastigenicdata. When heated to decomposition it emits very toxicfumes of HCl and NOx. | | Synthesis | Step 1: Tert-butyl hydrazinecarboxylate was reacted in acetone with MgSO4 and HOAc. The mixture was heated to reflux. After cooling and filtration, concentration gave a white solid (1).
Step 2: Compound (1) was dissolved in toluene with solid KOH and a phase-transfer catalyst. Benzyl bromide was added at 50C. The temperature was then raised to 80C. After completion, the mixture was washed, dried, and concentrated to give an oil (2f).
Step 3: 2N HCl was added to a THF solution of (2f). The mixture was heated at reflux. After concentration and drying, the dihydrochloride salt (3f) was obtained by filtration. |
| | BENZYLHYDRAZINE DIHYDROCHLORIDE Preparation Products And Raw materials |
|