TRANS,TRANS-1,4-DIPHENYL-1,3-BUTADIENE manufacturers
|
| | TRANS,TRANS-1,4-DIPHENYL-1,3-BUTADIENE Basic information |
| Product Name: | TRANS,TRANS-1,4-DIPHENYL-1,3-BUTADIENE | | Synonyms: | TRANS,TRANS-1,4-DIPHENYL-1,3-BUTADIENE;TRANS,TRANS-1,4-DIPHENYLBUTA-1,3-DIENE;T,T-1,4-DIPHENYL-1,3-BUTADIENE;(E,E)-(C6H5CH=CH)2;E,E)-1,4-Diphenylbutadiene;trans,trans-1,4-Diphenylbutadiene;(E)-1,4-DIPHENYLBUTA-1,3-DIENE;BETA,BETA'-BISTYRYL | | CAS: | 538-81-8 | | MF: | C16H14 | | MW: | 206.28 | | EINECS: | 629-554-7 | | Product Categories: | Acyclic;Alkenes;Analytical Reagents;Analytical/Chromatography;Biochemicals and Reagents;Building Blocks;Chemical Synthesis;Fluorescence/Luminescence Spectroscopy;Luminescent Compounds/Detection;Organic Building Blocks;Scintillation Reagents;Spectroscopy | | Mol File: | 538-81-8.mol |  |
| | TRANS,TRANS-1,4-DIPHENYL-1,3-BUTADIENE Chemical Properties |
| Melting point | 150-152 °C(lit.) | | Boiling point | 350 °C(lit.) | | density | 1.151 g/cm3 | | refractive index | 1.5000 (estimate) | | Fp | 350°C/720mm | | storage temp. | Sealed in dry,Room Temperature | | form | Crystals or Crystalline Powder | | color | White to slightly yellow | | Water Solubility | Slightly soluble in water. | | Merck | 14,3320 | | BRN | 1905937 | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C16H14/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-14H/b13-7+,14-8+ | | InChIKey | JFLKFZNIIQFQBS-FNCQTZNRSA-N | | SMILES | C(/C1=CC=CC=C1)=C\C=C\C1=CC=CC=C1 | | CAS DataBase Reference | 538-81-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-23 | | TSCA | Yes | | HS Code | 29029000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | TRANS,TRANS-1,4-DIPHENYL-1,3-BUTADIENE Usage And Synthesis |
| Chemical Properties | light yellow crystalline powder | | Uses | trans,trans-1,4-Diphenyl-1,3-butadiene reacts with Rieke metal complexes of barium and strontium to prepare metal-diene reagents, which is used for the carbocyclization with dichloroalkanes. | | Definition | ChEBI: 1,4-diphenylbutadiene is an alkadiene. It has a role as a fluorochrome. | | Purification Methods | Its solution in pet ether (b 60-70o) is chromatographed on an alumina-Celite column (4:1), and the column is washed with the same solvent. The main zone is cut out, eluted with ethanol and transferred to pet ether, which is then dried and evaporated [Pinckard et al. J Am Chem Soc 70 1938 1948]. Recrystallise it from hexane. [Beilstein 5 H 676, 9 IV 2319.] |
| | TRANS,TRANS-1,4-DIPHENYL-1,3-BUTADIENE Preparation Products And Raw materials |
|