- Demethylbellidifolin
-
-
2023-02-24
- CAS:2980-32-7
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | DESMETHYLBELLIDIFOLIN Basic information |
| Product Name: | DESMETHYLBELLIDIFOLIN | | Synonyms: | DESMETHYLBELLIDIFOLIN;1,3,5,8-Tetrahydroxy-9H-xanthene-9-one;1,3,5,8-Tetrahydroxy-9-xanthenone;1,3,5,8-Tetrahydroxy-9H-xanthen-9-one;Desmethylbellidifoline;Norbellidifodin;Bellidin;9H-Xanthen-9-one,1,3,5,8-tetrahydroxy- | | CAS: | 2980-32-7 | | MF: | C13H8O6 | | MW: | 260.2 | | EINECS: | | | Product Categories: | | | Mol File: | 2980-32-7.mol |  |
| | DESMETHYLBELLIDIFOLIN Chemical Properties |
| Melting point | 317℃ | | Boiling point | 605.6±55.0 °C(Predicted) | | density | 1.766 | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | pka | 6.54±0.20(Predicted) | | form | Solid | | color | Light yellow to green yellow | | InChI | InChI=1S/C13H8O6/c14-5-3-8(17)10-9(4-5)19-13-7(16)2-1-6(15)11(13)12(10)18/h1-4,14-17H | | InChIKey | MPXAWSABMVLIBU-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C(O)=CC=C2O)OC2=C1C(O)=CC(O)=C2 |
| | DESMETHYLBELLIDIFOLIN Usage And Synthesis |
| Chemical Properties | Yellow crystalline powder, soluble in methanol, ethanol, DMSO and other organic solvents. | | Uses | 1,3,5,8-Tetrahydroxy-9H-xanthen-9-one is an α-glucosidase inhibitor. | | Definition | ChEBI: A member of the class of xanthones that is xanthone which is substituted by hydroxy groups at positions 1, 3, 5, and 8. A natural product found particularly in Iris nigricans and Gentiana campestris. | | in vivo | 1,3,5,8-Tetrahydroxyxanthone (Desmethylbellidifolin; orally; 5, 10, 20 mg/kg; 12 days) can inhibit trinitrobenzenesulfonic acid (TNBS)-induced ulcerative colitis (UC), reducing inflammatory response and alleviate colon muscle spasm[1]. |
| | DESMETHYLBELLIDIFOLIN Preparation Products And Raw materials |
|