|
|
| | (R)-(-)-O-Formylmandeloyl chloride Basic information |
| Product Name: | (R)-(-)-O-Formylmandeloyl chloride | | Synonyms: | FORMYLOXYMANDELOYL CHLORIDE;D-(-)-O-FORMYL MANDELOYL CHLORIDE;D(-)ALPHA-FORMYLOXY-ALPHA-PHENYLACETYLCHLORIDE;R(-)-ALPHA-(FORMYLOXY)PHENYLACETYLCHLORIDE;(R)-(-)-O-FORMYLMANDELOYL CHLORID;(R)-2-Chloro-2-oxo-1-phenylethyl forMate;(R)-alpha-(Chlorocarbonyl)benzyl formate;(-)-O-FORMYL-D-MANDELOYL CHLORIDE | | CAS: | 29169-64-0 | | MF: | C9H7ClO3 | | MW: | 198.6 | | EINECS: | 249-478-4 | | Product Categories: | chiral | | Mol File: | 29169-64-0.mol |  |
| | (R)-(-)-O-Formylmandeloyl chloride Chemical Properties |
| Boiling point | 221 °C(lit.) | | density | 1.290 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.523(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Optical Rotation | [α]23/D 228°, neat | | BRN | 5404068 | | InChI | 1S/C9H7ClO3/c10-9(12)8(13-6-11)7-4-2-1-3-5-7/h1-6,8H/t8-/m1/s1 | | InChIKey | YASBRFHEBZXBJW-SSDOTTSWSA-N | | SMILES | ClC(=O)[C@H](OC=O)c1ccccc1 | | CAS DataBase Reference | 29169-64-0(CAS DataBase Reference) | | EPA Substance Registry System | Benzeneacetyl chloride, .alpha.-(formyloxy)-, (.alpha.R)- (29169-64-0) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29181990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | (R)-(-)-O-Formylmandeloyl chloride Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | (R)-()-O-Formylmandeloyl chloride can be used as a chiral resolving agent for the resolution of spirobiindane. |
| | (R)-(-)-O-Formylmandeloyl chloride Preparation Products And Raw materials |
|