|
|
| | 3,5-Pyridinedicarboxylic acid Basic information |
| | 3,5-Pyridinedicarboxylic acid Chemical Properties |
| Melting point | >300 °C (lit.) | | Boiling point | 295.67°C (rough estimate) | | density | 1.5216 (rough estimate) | | refractive index | 1.6280 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | 1.0g/l | | form | Powder | | pka | 2.8(at 25℃) | | color | White to almost white | | Water Solubility | insoluble | | BRN | 131640 | | InChI | InChI=1S/C7H5NO4/c9-6(10)4-1-5(7(11)12)3-8-2-4/h1-3H,(H,9,10)(H,11,12) | | InChIKey | MPFLRYZEEAQMLQ-UHFFFAOYSA-N | | SMILES | C1=NC=C(C(O)=O)C=C1C(O)=O | | CAS DataBase Reference | 499-81-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36-24/25-36/37/39 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,5-Pyridinedicarboxylic acid Usage And Synthesis |
| Chemical Properties | White crystal powder | | Uses | 3,5-Pyridinedicarboxylic Acid is a competitive inhibitor of butyrobetaine hydroxylase. It is also used as organic synthesis and pharmaceutical intermediates. | | Definition | ChEBI: Dinicotinic acid is a pyridinedicarboxylic acid. It is a conjugate acid of a dinicotinate(1-). | | Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 4, p. 137, 1967 DOI: 10.1002/jhet.5570040127 |
| | 3,5-Pyridinedicarboxylic acid Preparation Products And Raw materials |
|