Neodymium(III) acetate hydrate manufacturers
|
| | Neodymium(III) acetate hydrate Basic information |
| Product Name: | Neodymium(III) acetate hydrate | | Synonyms: | NeodyMiuM acetat;NEODYMIUM ACETATE TETRAHYDRATE;NEODYMIUM(III) ACETATE HYDRATE;Acetic acid neodymium salt hydrate;Neodymium(III) acetate hydrate (REO);NeodyMiuM(III) acetate hexahydrate;Neodymium(III) acetate hydrate, 99.9% (REO);Neodymium (III) acetate tetrahydrate | | CAS: | 334869-71-5 | | MF: | C2H6NdO3 | | MW: | 222.31 | | EINECS: | 629-417-1 | | Product Categories: | | | Mol File: | 334869-71-5.mol |  |
| | Neodymium(III) acetate hydrate Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | form | Crystalline | | Water Solubility | Soluble in water, moderately soluble in strong mineral acids. | | InChI | 1S/3C2H4O2.Nd.H2O/c3*1-2(3)4;;/h3*1H3,(H,3,4);;1H2/q;;;+3;/p-3 | | InChIKey | GMQPBTKWMZBSCT-UHFFFAOYSA-K | | SMILES | O.CC(=O)O[Nd](OC(C)=O)OC(C)=O | | CAS DataBase Reference | 334869-71-5 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | Yes | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Neodymium(III) acetate hydrate Usage And Synthesis |
| Uses | Neodymium Acetate, mainly used for glass, crystal and capacitors. It is useful in protective lenses for welding goggles. It is also used in CRT displays to enhance contrast between reds and greens. It is highly valued in glass manufacturing for its attractive purple coloring to glass. | | reaction suitability | core: neodymium
reagent type: catalyst |
| | Neodymium(III) acetate hydrate Preparation Products And Raw materials |
|