|
|
| | 3,4,5-Trimethoxyphenylacetonitrile Basic information |
| Product Name: | 3,4,5-Trimethoxyphenylacetonitrile | | Synonyms: | (3,4,5-trimethoxyphenyl)-acetonitril;3,4,5-trimethoxybenzeneacetonitrile;3,4,5-trimethoxybenzylnitrile;3,4,5-trimethoxyphenylacetylnitryl;LABOTEST-BB LT00847929;3,4,5-TRIMETHOXYPHENYLACETONITRILE;3,4,5-TRIMETHOXYBENZYL CYANIDE;3,4,5-TRIMETHOXYPHENYLACETONITRILE (SEE 1942) | | CAS: | 13338-63-1 | | MF: | C11H13NO3 | | MW: | 207.23 | | EINECS: | 236-388-5 | | Product Categories: | Aromatic Nitriles;API intermediates;Building Blocks;C10 to C27;Chemical Synthesis;Cyanides/Nitriles;Nitrogen Compounds;Organic Building Blocks | | Mol File: | 13338-63-1.mol |  |
| | 3,4,5-Trimethoxyphenylacetonitrile Chemical Properties |
| Melting point | 77-79 °C (lit.) | | Boiling point | 346.25°C (rough estimate) | | density | 1.1878 (rough estimate) | | refractive index | 1.5100 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystaline | | color | White to Light yellow | | BRN | 2214548 | | Exposure limits | NIOSH: IDLH 25 mg/m3 | | InChI | InChI=1S/C11H13NO3/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3/h6-7H,4H2,1-3H3 | | InChIKey | ACFJNTXCEQCDBX-UHFFFAOYSA-N | | SMILES | C1(CC#N)=CC(OC)=C(OC)C(OC)=C1 | | CAS DataBase Reference | 13338-63-1(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36-24/25 | | RIDADR | 3276 | | WGK Germany | 3 | | RTECS | AM2475000 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 |
| | 3,4,5-Trimethoxyphenylacetonitrile Usage And Synthesis |
| Chemical Properties | WHITE TO BEIGE FINE CRYSTALLINE POWDER | | Uses | 3,4,5-Trimethoxyphenylacetonitrile is used in insecticide compositions. | | General Description | 3,4,5-Trimethoxyphenylacetonitrile is synthesized by the condensation of 3 : 4 : 5-trimethoxybenzaldehyde with hippuric acid. |
| | 3,4,5-Trimethoxyphenylacetonitrile Preparation Products And Raw materials |
|