| Company Name: |
Zibo Yintai Medical Technology Co., LTD Gold
|
| Tel: |
18766946537 |
| Email: |
2271916572@qq.com |
| Products Intro: |
Product Name:2,5-Dicyclopentylidenecyclopentane-1-one
CAS:5682-82-6
Purity:95%+HPLC Package:1g，100g
|
| Company Name: |
Zhengzhou Alfachem Co., Ltd.
|
| Tel: |
0371-53765687 18937137882 |
| Email: |
2853979813@qq.com |
| Products Intro: |
Product Name:2,5-Dicyclopentylidenecyclopentane-1-one
CAS:5682-82-6
Purity:98%
|
| Company Name: |
Zhengzhou anmousse chemical products co. LTD
|
| Tel: |
0371-55289822 18737195735 |
| Email: |
483339295@qq.com |
| Products Intro: |
Product Name:2,5-Dicyclopentylidenecyclopentane-1-one
CAS:5682-82-6
Purity:98% Package:5g;10g;25g;50g;100g
|
| Company Name: |
Jiangsu Aikon Biopharmaceutical R&D co.,Ltd.
|
| Tel: |
025-025-66113011 18626450290 |
| Email: |
cb5@aikonchem.com |
| Products Intro: |
Product Name:2,5-Dicyclopentylidenecyclopentane-1-one
CAS:5682-82-6
Purity:95% Package:1g;5g;10g
|
|
| | 2,5-Dicyclopentylidenecyclopentane-1-one Basic information |
| | 2,5-Dicyclopentylidenecyclopentane-1-one Chemical Properties |
| Melting point | 82 °C | | Boiling point | 170 °C(Press: 5 Torr) | | density | 1.147±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C15H20O/c16-15-13(11-5-1-2-6-11)9-10-14(15)12-7-3-4-8-12/h1-10H2 | | InChIKey | JGQLYIJWTIOPQK-UHFFFAOYSA-N | | SMILES | C1(=O)/C(=C2\CCCC\2)/CC/C/1=C1\CCCC\1 |
| | 2,5-Dicyclopentylidenecyclopentane-1-one Usage And Synthesis |
| | 2,5-Dicyclopentylidenecyclopentane-1-one Preparation Products And Raw materials |
|