|
|
| | 3-Bromo-5-chlorophenylboronic acid Basic information |
| Product Name: | 3-Bromo-5-chlorophenylboronic acid | | Synonyms: | 3-Bromo-5-chlorophenylboronic acid;BORONIC ACID, B-(3-BROMO-5-CHLOROPHENYL)-;B-(3-Bromo-5-chlorophenyl)boronic acid;3-Bromo-5-chlorophenylboronic acid 97%;3-Bromo-5-chlorophenylboronic acid(contains varying amounts of Anhydride) | | CAS: | 1186403-17-7 | | MF: | C6H5BBrClO2 | | MW: | 235.27 | | EINECS: | | | Product Categories: | | | Mol File: | 1186403-17-7.mol |  |
| | 3-Bromo-5-chlorophenylboronic acid Chemical Properties |
| Boiling point | 367.0±52.0 °C(Predicted) | | density | 1.79 | | storage temp. | Inert atmosphere,2-8°C | | pka | 6.58±0.10(Predicted) |
| | 3-Bromo-5-chlorophenylboronic acid Usage And Synthesis |
| Uses | 3-Bromo-5-chlorophenylboronic Acid is a reagent used to prepare for a series of indole amidines as inhibitor of acid-sensing ion channel-3 (ASIC3) for the treatment of chronic pain. |
| | 3-Bromo-5-chlorophenylboronic acid Preparation Products And Raw materials |
|