| Company Name: |
Tangshan Moneide Trading Co., Ltd.
|
| Tel: |
0315-8309571 15633399667 |
| Email: |
sales@moneidechem.com |
| Products Intro: |
Product Name:2-(Diphenylphosphino)-2',6'-dimethoxybiphenyl
Purity:98%min. Package:100g;500g;1kg;25kg
|
| Company Name: |
Accendatech Co., LTD.
|
| Tel: |
13132578992 |
| Email: |
sales@accendatech.com |
| Products Intro: |
Product Name:2-(Diphenylphosphino)-2',6'-diMethoxybiphenyl
Package:10g~1Kg
|
| Company Name: |
Cantotech Chemicals, Ltd.
|
| Tel: |
86-0755-86635001 |
| Email: |
cantotech@126.com |
| Products Intro: |
Product Name:2-(Diphenylphosphino)-2',6'-diMethoxybiphenyl
Purity:98%+ Package:100G; 500G; 1KG
|
|
| | 2-(Diphenylphosphino)-2',6'-dimethoxybiphenyl Basic information |
| | 2-(Diphenylphosphino)-2',6'-dimethoxybiphenyl Chemical Properties |
| InChI | InChI=1S/C26H23O2P/c1-27-23-17-11-18-24(28-2)26(23)22-16-9-10-19-25(22)29(20-12-5-3-6-13-20)21-14-7-4-8-15-21/h3-19H,1-2H3 | | InChIKey | SCPQRAVWOIURIW-UHFFFAOYSA-N | | SMILES | C1(C2=C(OC)C=CC=C2OC)=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1 |
| | 2-(Diphenylphosphino)-2',6'-dimethoxybiphenyl Usage And Synthesis |
| | 2-(Diphenylphosphino)-2',6'-dimethoxybiphenyl Preparation Products And Raw materials |
|