|
|
| | (S)-N-(1-aMino-1-oxobutan-2-yl)-4-chlorobutanaMide Basic information |
| Product Name: | (S)-N-(1-aMino-1-oxobutan-2-yl)-4-chlorobutanaMide | | Synonyms: | (S)-N-(1-aMino-1-oxobutan-2-yl)-4-chlorobutanaMide;Levetiracetam Related Compound A (20 mg) ((S)-N-(1-amino-1-oxobutan-2-yl)-4-chlorobutanamide);(S)-N-[1-(AMinocarbonyl)propyl]-4-chlorobutanaMide;N-[(1S)-1-(AMinocarbonyl)propyl]-4-chlorobutanaMide;LevetiracetaM Related CoMpound A;Levetiracetam USP RC A;Levetiracetam Impurity E;Levitiracetam Related compound A | | CAS: | 102767-31-7 | | MF: | C8H15ClN2O2 | | MW: | 206.67 | | EINECS: | | | Product Categories: | | | Mol File: | 102767-31-7.mol |  |
| | (S)-N-(1-aMino-1-oxobutan-2-yl)-4-chlorobutanaMide Chemical Properties |
| Boiling point | 453.2±30.0 °C(Predicted) | | density | 1.154±0.06 g/cm3(Predicted) | | pka | 14.54±0.46(Predicted) | | BRN | 13476773 | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C8H15ClN2O2/c1-2-6(8(10)13)11-7(12)4-3-5-9/h6H,2-5H2,1H3,(H2,10,13)(H,11,12)/t6-/m0/s1 | | InChIKey | QBJNYRYTZPBHFT-LURJTMIESA-N | | SMILES | C(N[C@H](C(N)=O)CC)(=O)CCCCl |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | HS Code | 2924190002 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | (S)-N-(1-aMino-1-oxobutan-2-yl)-4-chlorobutanaMide Usage And Synthesis |
| Uses | (S)-N-(1-Amino-1-oxobutan-2-yl)-4-chlorobutanamide is a related compound of Levetiracetam (L331500). Levetiracetam related compound A. |
| | (S)-N-(1-aMino-1-oxobutan-2-yl)-4-chlorobutanaMide Preparation Products And Raw materials |
|