|
|
| | L-Valine 2-Hydroxyethyl Ester 4-Methylbenzenesulfonate Basic information |
| | L-Valine 2-Hydroxyethyl Ester 4-Methylbenzenesulfonate Chemical Properties |
| Melting point | 132-135°C | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | color | White to Off-White | | Major Application | pharmaceutical | | InChI | 1S/C7H15NO3.C7H8O3S/c1-5(2)6(8)7(10)11-4-3-9;1-6-2-4-7(5-3-6)11(8,9)10/h5-6,9H,3-4,8H2,1-2H3;2-5H,1H3,(H,8,9,10)/t6-;/m0./s1 | | InChIKey | KIQNQGPNCRYWKY-RGMNGODLSA-N | | SMILES | CC(C)[C@H](N)C(=O)OCCO.Cc1ccc(cc1)S(O)(=O)=O |
| WGK Germany | WGK 3 | | HS Code | 2922505000 | | Storage Class | 13 - Non Combustible Solids |
| | L-Valine 2-Hydroxyethyl Ester 4-Methylbenzenesulfonate Usage And Synthesis |
| Uses | L-Valine 2-Hydroxyethyl Ester Tosylate is a L-Valacyclovir Hydrochloride (V085000) related compound F, which is the L-Valine ester prodrug of Acyclovir. | | Uses | Valacyclovir (V085000) related compound F. |
| | L-Valine 2-Hydroxyethyl Ester 4-Methylbenzenesulfonate Preparation Products And Raw materials |
|