|
1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluorooctane, (Perfluorohex-1-yl)ethane Suppliers list
|
1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluorooctane, (Perfluorohex-1-yl)ethane manufacturers
- 1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluorooctane, (Perfluorohex-1-yl)ethane
-
-
2025-04-04
- CAS:80793-17-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1Ton
|
| | 1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluorooctane, (Perfluorohex-1-yl)ethane Basic information | | Uses |
| Product Name: | 1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluorooctane, (Perfluorohex-1-yl)ethane | | Synonyms: | 1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluorooctane, (Perfluorohex-1-yl)ethane;1H,1H,1H,2H,2H-Perfluorooctane 97%;1,1,1,2,2-Pentahydroperfluorooctane;AC 6000;HFC 76-13;HFC 76-13sf;Perfluorohexylethane;1H,1H,1H,2H,2H-Perfluorooctane97% | | CAS: | 80793-17-5 | | MF: | C8H5F13 | | MW: | 348.1 | | EINECS: | 700-684-7 | | Product Categories: | | | Mol File: | 80793-17-5.mol |  |
| | 1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluorooctane, (Perfluorohex-1-yl)ethane Chemical Properties |
| Melting point | -81 °C | | Boiling point | 121.2±8.0 °C(Predicted) | | density | 1.502±0.06 g/cm3(Predicted) | | vapor pressure | 38.5-38.53hPa at 20℃ | | refractive index | < 1.3 @ 20 °C | | Fp | > 100°C | | form | Liquid | | InChI | InChI=1S/C8H5F13/c1-2-3(9,10)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h2H2,1H3 | | InChIKey | SKRWRXWNQFQGRU-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC | | LogP | 5.3 | | EPA Substance Registry System | 1-(Perfluorohexyl)ethane (80793-17-5) |
| | 1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluorooctane, (Perfluorohex-1-yl)ethane Usage And Synthesis |
| Uses | Perfluorohexylethane is a hydrocarbon organic compound that can be used as a perfluorinated material. |
| | 1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluorooctane, (Perfluorohex-1-yl)ethane Preparation Products And Raw materials |
|