|
|
| | Benzeneacetic acid, 2-[(4-chlorophenyl)thio]- Basic information |
| Product Name: | Benzeneacetic acid, 2-[(4-chlorophenyl)thio]- | | Synonyms: | Benzeneacetic acid, 2-[(4-chlorophenyl)thio]-;[2-[(4-Chlorophenyl)thio]phenyl]acetic acid;2-[(4-Chlorophenyl)thio]benzeneacetic acid;2-(2-((4-Chlorophenyl)thio)phenyl)acetic acid;2-[(4-chlorophenyl)thio]-;-(2-((4-chlorophenyl)thio)phenyl)aceticacid;2-(4-Chlorphenylthio)-phenylessigsaeure;1-Propanol,3-[(tetrahydro-2H-pyran-6-yl)oxy]- | | CAS: | 13459-62-6 | | MF: | C14H11ClO2S | | MW: | 278.75 | | EINECS: | 200-001-8 | | Product Categories: | | | Mol File: | 13459-62-6.mol | ![Benzeneacetic acid, 2-[(4-chlorophenyl)thio]- Structure](CAS/20150408/GIF/13459-62-6.gif) |
| | Benzeneacetic acid, 2-[(4-chlorophenyl)thio]- Chemical Properties |
| Melting point | 116℃ | | Boiling point | 434.4±35.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | pka | 4.13±0.10(Predicted) | | InChI | InChI=1S/C14H11ClO2S/c15-11-5-7-12(8-6-11)18-13-4-2-1-3-10(13)9-14(16)17/h1-8H,9H2,(H,16,17) | | InChIKey | WZICWIASCZNZHO-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=CC=C1SC1=CC=C(Cl)C=C1 |
| | Benzeneacetic acid, 2-[(4-chlorophenyl)thio]- Usage And Synthesis |
| | Benzeneacetic acid, 2-[(4-chlorophenyl)thio]- Preparation Products And Raw materials |
|