|
|
| | Benzyl glycinate p-toluenesulfonate Basic information |
| | Benzyl glycinate p-toluenesulfonate Chemical Properties |
| Melting point | 132-134 °C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | methanol: 0.1 g/mL, clear | | form | Solid | | color | White to Off-White | | Water Solubility | almost transparency | | BRN | 3600116 | | InChI | InChI=1S/C9H11NO2.C7H8O3S/c10-6-9(11)12-7-8-4-2-1-3-5-8;1-6-2-4-7(5-3-6)11(8,9)10/h1-5H,6-7,10H2;2-5H,1H3,(H,8,9,10) | | InChIKey | WJKJXKRHMUXQSL-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=CC=C(C)C=C1.C(OCC1=CC=CC=C1)(=O)CN | | CAS DataBase Reference | 1738-76-7(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29225090 |
| | Benzyl glycinate p-toluenesulfonate Usage And Synthesis |
| Chemical Properties | White crystalline | | Uses | Glycine benzyl ester p-toluenesulfonate salt is a potent crosslinking inhibitor. | | Uses | Racecodotril intermediate | | Uses | Potent crosslinking inhibitors |
| | Benzyl glycinate p-toluenesulfonate Preparation Products And Raw materials |
|