| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione Basic information |
| Product Name: | 2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione | | Synonyms: | 7,7-dimethyl-1,1,1,2,2,3,3-heptafluoro-4,6-octanedione;fod-h;(Heptafluorobutanoyl)pivaloylmethane.;1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione 98%;1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione98%;2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-;6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL-3,5-OCTANEDIONE HFOD;2,2-DIMETHYL-6,6,7,7,8,8,8-HEPTAFLUORO-3,5-OCTANEDIONE 98% | | CAS: | 17587-22-3 | | MF: | C10H11F7O2 | | MW: | 296.18 | | EINECS: | 241-556-6 | | Product Categories: | Achiral Oxygen;organofluorine compounds | | Mol File: | 17587-22-3.mol |  |
| | 2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione Chemical Properties |
| Melting point | 38 °C | | Boiling point | 46-47 °C/5 mmHg (lit.) | | density | 1.273 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.379(lit.) | | Fp | 101 °F | | storage temp. | Inert atmosphere,2-8°C | | form | liquid | | pka | 6.74±0.46(Predicted) | | Specific Gravity | 1.273 | | color | colorless to pale yellow | | BRN | 2056991 | | Stability: | Stable. Flammable. Incompatible with oxidizing agents, combustible material. | | InChI | 1S/C10H11F7O2/c1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17/h4H2,1-3H3 | | InChIKey | SQNZLBOJCWQLGQ-UHFFFAOYSA-N | | SMILES | CC(C)(C)C(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 17587-22-3(CAS DataBase Reference) | | EPA Substance Registry System | 3,5-Octanedione, 6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl- (17587-22-3) |
| Hazard Codes | Xi,F | | Risk Statements | 10-37 | | Safety Statements | 23-24/25 | | RIDADR | UN 1224 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Flammable | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29147000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | 2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione Usage And Synthesis |
| Chemical Properties | colourless liquid | | Uses | 6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedione (2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione) was used as a co-inducer in the production of human γ interferon (HuIFN-γ). It was also used as a beta-diketone chelating agent in the extraction of supercritical carbon dioxide. |
| | 2,2-Dimethyl-6,6,7,7,8,8,8-heptafluoro-3,5-octanedione Preparation Products And Raw materials |
|