4,4'-(1,2-Diphenylethene-1,2-diyl)diphenol manufacturers
|
| | 4,4'-(1,2-Diphenylethene-1,2-diyl)diphenol Basic information |
| Product Name: | 4,4'-(1,2-Diphenylethene-1,2-diyl)diphenol | | Synonyms: | 4,4'-(1,2-Diphenylethene-1,2-diyl)diphenol;1,2-Bis(4-hydroxyphenyl)-1,2-dip;1,2-Bis(4-hydroxyphenyl)-1,2-diphenylethylene;Phenol, 4,4'-(1,2-diphenyl-1,2-ethenediyl)bis-;4,4'-(1,2-diphenyl-1,2-ethenediyl)bis-Phenol;1,2-Bis(4-hydroxyphenyl)-1,2-diphenylethylenef;4-[2-(4-hydroxyphenyl)-1,2-diphenylethenyl]phenol;4,4'-(1,2-Diphenylethene-1,2-diyl)diphenol (cis- and trans- mixture) | | CAS: | 68578-79-0 | | MF: | C26H20O2 | | MW: | 364.44 | | EINECS: | | | Product Categories: | | | Mol File: | 68578-79-0.mol |  |
| | 4,4'-(1,2-Diphenylethene-1,2-diyl)diphenol Chemical Properties |
| Melting point | 225°C (lit.) | | Boiling point | 488.8±40.0 °C(Predicted) | | density | 1.205±0.06 g/cm3(Predicted) | | storage temp. | RT, stored under nitrogen | | pka | 8.78±0.15(Predicted) | | form | powder | | Appearance | White to off-white Solid | | InChI | InChI=1S/C26H20O2/c27-23-15-11-21(12-16-23)25(19-7-3-1-4-8-19)26(20-9-5-2-6-10-20)22-13-17-24(28)18-14-22/h1-18,27-28H | | InChIKey | ZYIGFXHZSKIVOO-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(O)C=C1)(C1=CC=CC=C1)=C(C1=CC=C(O)C=C1)C1=CC=CC=C1 |
| | 4,4'-(1,2-Diphenylethene-1,2-diyl)diphenol Usage And Synthesis |
| Uses | TPE-DOH is a synthetic intermediate of aggregation-induced emission (AIE) dye for use in further synthesis of alkyl-halogen to make ether and polymer reaction via esterification. |
| | 4,4'-(1,2-Diphenylethene-1,2-diyl)diphenol Preparation Products And Raw materials |
|