|
|
| | (R)-3-Aminoquinuclidine dihydrochloride Basic information |
| | (R)-3-Aminoquinuclidine dihydrochloride Chemical Properties |
| Melting point | >300 °C(lit.) | | alpha | 24 º (c=1, H2O) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly, Heated, Sonicated), Methanol (Slightly, Heated, Sonicated) | | form | Powder | | color | White to beige | | Optical Rotation | [α]20/D +24°, c = 1 in H2O | | Stability: | Hygroscopic | | InChI | InChI=1/C7H14N2.2ClH/c8-7-5-9-3-1-6(7)2-4-9;;/h6-7H,1-5,8H2;2*1H | | InChIKey | STZHBULOYDCZET-UHFFFAOYNA-N | | SMILES | [C@@]12([H])CCN(CC1)CC2N.Cl.Cl |&1:0,r| | | CAS DataBase Reference | 123536-14-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-R36/37/38 | | Safety Statements | 26-38-36-S36-S26 | | WGK Germany | 3 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-3-Aminoquinuclidine dihydrochloride Usage And Synthesis |
| Chemical Properties | (R)-3-Aminoquinuclidine dihydrochloride is White to beige powder | | Uses | This diamine and its antipode are important building blocks in the synthesis of pharmaceuticals. | | Uses | (R)-3-Aminoquinuclidine dihydrochloride is used in the preparation of serotonin type 3 (5-HT3) receptor antagonist as potential new drugs for the treatment of irritable bowel syndrome (IBS). |
| | (R)-3-Aminoquinuclidine dihydrochloride Preparation Products And Raw materials |
|