| Company Name: |
ChemShuttle, Inc. |
| Tel: |
0510-83588313-811 18800520310 |
| Email: |
sales@chemshuttle.com |
N1,N2-bis(4-hydroxy-2,6-dimethylphenyl)oxalamide manufacturers
|
| | N1,N2-bis(4-hydroxy-2,6-dimethylphenyl)oxalamide Basic information |
| Product Name: | N1,N2-bis(4-hydroxy-2,6-dimethylphenyl)oxalamide | | Synonyms: | N1,N2-bis(4-hydroxy-2,6-dimethylphenyl)oxalamide;Ethanediamide, N1,N2-bis(4-hydroxy-2,6-dimethylphenyl)-;N1,N2-bis(4-hydroxy-2,6-dimethylphenyl)oxalamide ISO 9001：2015 REACH;N,N'-bis(4-hydroxy-2,6-dimethylphenyl)oxamid;N,N'-bis(4-hydroxy-2,6-dimethyl-phenyl)oxamide;N1,N2-bis(4-hydroxy-2,6-dimethylphenyl)-ethyldiamide;N,N'-bis(4-hydroxy-2,6-dimethylphenyl)oxamide;N,N'-bis(4-hydroxy-2,6-dimethylphenyl)ethanediamide | | CAS: | 1809288-95-6 | | MF: | C18H20N2O4 | | MW: | 328.36 | | EINECS: | | | Product Categories: | | | Mol File: | 1809288-95-6.mol |  |
| | N1,N2-bis(4-hydroxy-2,6-dimethylphenyl)oxalamide Chemical Properties |
| density | 1.337±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 9.73±0.36(Predicted) | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C18H20N2O4/c1-9-5-13(21)6-10(2)15(9)19-17(23)18(24)20-16-11(3)7-14(22)8-12(16)4/h5-8,21-22H,1-4H3,(H,19,23)(H,20,24) | | InChIKey | VGDOSNKYJILNDC-UHFFFAOYSA-N | | SMILES | C(NC1=C(C)C=C(O)C=C1C)(=O)C(NC1=C(C)C=C(O)C=C1C)=O |
| | N1,N2-bis(4-hydroxy-2,6-dimethylphenyl)oxalamide Usage And Synthesis |
| Uses | N1,N2-Bis(4-hydroxy-2,6-dimethylphenyl)ethanediamide is an intermediate used in the synthesis of 1-Naphthol-d7 (d6 Major) (N367993), which is the isotope labelled analog of 1-Naphthol (N367990), a compound commonly used in the manufacturing of dyes, intermediates, synthetic perfumes. |
| | N1,N2-bis(4-hydroxy-2,6-dimethylphenyl)oxalamide Preparation Products And Raw materials |
|