|
|
| | ETHYL 3-(1-ADAMANTYL)-3-OXOPROPIONATE Basic information |
| | ETHYL 3-(1-ADAMANTYL)-3-OXOPROPIONATE Chemical Properties |
| Melting point | 108-110℃ | | Boiling point | 108-110 °C0.06 mm Hg(lit.) | | density | 1.037 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.499(lit.) | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 10.63±0.20(Predicted) | | form | liquid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C15H22O3/c1-2-18-14(17)6-13(16)15-7-10-3-11(8-15)5-12(4-10)9-15/h10-12H,2-9H2,1H3/t10-,11+,12-,15- | | InChIKey | FOISHGXCIBGQJU-WUQLGEGHSA-N | | SMILES | CCOC(=O)CC(=O)C12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
| WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 10 - Combustible liquids |
| | ETHYL 3-(1-ADAMANTYL)-3-OXOPROPIONATE Usage And Synthesis |
| Uses | Ethyl 3-(1-adamantyl)-3-oxopropionate may be used in chemical synthesis studies. |
| | ETHYL 3-(1-ADAMANTYL)-3-OXOPROPIONATE Preparation Products And Raw materials |
|