- D-Mannono-1,4-lactone
-
- $0.00 / 10G
-
2025-11-03
- CAS:26301-79-1
- Min. Order: 10G
- Purity: 98%min
- Supply Ability: 30kg/month
|
| | D-MANNONO-1,4-LACTONE Basic information |
| Product Name: | D-MANNONO-1,4-LACTONE | | Synonyms: | MANNONIC ACID-GAMMA-LACTONE, D-;D-MANNONO-1,4-LACTONE;D-MANNONIC ACID-GAMMA-LACTONE;1,4-D-Mannonolactone;gamma-Lactone of mannonic acid;D-MANNONO-1,4-LACTONE 95+%;D-Mannonicacid-1,4-lactone;(3S)-3β,4β-Dihydroxy-5β-[(R)-1,2-dihydroxyethyl]-4,5-dihydro-2(3H)-furanone | | CAS: | 26301-79-1 | | MF: | C6H10O6 | | MW: | 178.14 | | EINECS: | 247-596-0 | | Product Categories: | Biochemistry;Sugar Acids;Sugars | | Mol File: | 26301-79-1.mol |  |
| | D-MANNONO-1,4-LACTONE Chemical Properties |
| Melting point | 153 °C | | Boiling point | 467.9±18.0 °C(Predicted) | | density | 1.766±0.06 g/cm3(Predicted) | | pka | 12.06±0.60(Predicted) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | within almost transparency | | InChI | InChI=1/C6H10O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-5,7-10H,1H2/t2-,3-,4+,5-/s3 | | InChIKey | SXZYCXMUPBBULW-NTFFWLJGNA-N | | SMILES | [C@@H]([C@@]1([H])OC(=O)[C@@H](O)[C@H]1O)(O)CO |&1:0,1,6,8,r| |
| | D-MANNONO-1,4-LACTONE Usage And Synthesis |
| Chemical Properties | White solid | | Uses | D-Mannono-1,4-lactone acts as an inhibitor to β-galactosidase of Escherichia coli providing proof that the furanose form of this sugar was contributory to its efficacy. |
| | D-MANNONO-1,4-LACTONE Preparation Products And Raw materials |
|