(R)-5,7-difluorochroman-4-ol manufacturers
|
| | (R)-5,7-difluorochroman-4-ol Basic information |
| Product Name: | (R)-5,7-difluorochroman-4-ol | | Synonyms: | 2H-1-Benzopyran-4-ol, 5,7-difluoro-3,4-dihydro-, (4R)-;Tegoprazan Impurity 11;R-5,7-difluorobenzo dihydropyran-4-ol;(4R)-5,7-difluoro-3,4-dihydro-2H-1-benzopyran-4-ol;[2-(2-chlorophenyl)ethanamine, 1-Amino-2-(2-chlorophenyl)ethane, 2-(2-Chlorophenyl)ethylamine];(R)-5, 7-difluorobenzopyrane-4-ol;Tegoprazan side chain;Tegoprazan ImpuritiesC | | CAS: | 1270294-05-7 | | MF: | C9H8F2O2 | | MW: | 186.16 | | EINECS: | | | Product Categories: | API | | Mol File: | 1270294-05-7.mol |  |
| | (R)-5,7-difluorochroman-4-ol Chemical Properties |
| Boiling point | 228.4±40.0 °C(Predicted) | | density | 1.402±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 13.09±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H8F2O2/c10-5-3-6(11)9-7(12)1-2-13-8(9)4-5/h3-4,7,12H,1-2H2/t7-/m1/s1 | | InChIKey | HGTYMLFMXKYIQW-SSDOTTSWSA-N | | SMILES | C1OC2=CC(F)=CC(F)=C2[C@H](O)C1 |
| | (R)-5,7-difluorochroman-4-ol Usage And Synthesis |
| Uses |
(R)-5,7-difluorochroman-4-ol is an important intermediate in the synthesis of tegoprazan[1].
| | Production Methods | Preparing (R)-5,7-difluorochroman-4-ol involves taking 5, 7-difluorochroman-4-one as substrate and performing asymmetric reduction reaction in the presence of ketoreductase, coenzyme and coenzyme circulating system to obtain (R)-5,7-difluorochroman-4-ol, where ketoreductase is one or combination of two or more of short-chain dehydrogenases/reductases family (SDR), medium-chain dehydrogenases/reductase (MDR) or aldo-Keto reductase (AKR)[1].
| | References | [1]PAN X, et al. "Preparing (R)-5,7-difluorochroman-4-ol involves taking 5, 7-difluorochroman-4-one as substrate, and performing asymmetric reduction reaction in the presence of ketoreductase, coenzyme and coenzyme circulating system to obtain (R)-5,7-difluorochroman-4-ol.", CN202210486605.0. 2022.
|
| | (R)-5,7-difluorochroman-4-ol Preparation Products And Raw materials |
|