|
|
| | 2-iodo-1-phenylpentan-1-one Basic information |
| Product Name: | 2-iodo-1-phenylpentan-1-one | | Synonyms: | 2-iodo-1-phenyl-1-pentanone;alpha-Iodovalerophenone;2-iodo-1-phenyl-pentane-1-one CAS 124878-55-3;1-Pentanone, 2-iodo-1-phenyl-;2-IODO-1-PHENYL-PENTANE-1-ONE;2-iodo-1-phenylpentan-1-one;e 2-iodo-1-phenyl-pentane-1-one | | CAS: | 124878-55-3 | | MF: | C11H13IO | | MW: | 288.12 | | EINECS: | 226-500-0 | | Product Categories: | | | Mol File: | 124878-55-3.mol |  |
| | 2-iodo-1-phenylpentan-1-one Chemical Properties |
| Boiling point | 317.5±25.0 °C(Predicted) | | density | 1.518±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C11H13IO/c1-2-6-10(12)11(13)9-7-4-3-5-8-9/h3-5,7-8,10H,2,6H2,1H3 | | InChIKey | BKVFBNAVBVPWEX-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(=O)C(I)CCC |
| | 2-iodo-1-phenylpentan-1-one Usage And Synthesis |
| Chemical Properties | 2-iodo-1-phenylpentan-1-one is a yellow liquid. It is a organic intermediate.
 |
| | 2-iodo-1-phenylpentan-1-one Preparation Products And Raw materials |
|