|
|
| | 4-Hydroxy-2,6-dimethylpyridine Basic information |
| Product Name: | 4-Hydroxy-2,6-dimethylpyridine | | Synonyms: | 2,6-DIMETHYL-PYRIDIN-4-OL;2,6-DIMETHYL-4-HYDROXYPYRIDINE;2,6-Dimethyl-4-hydroxypyridine 98%;2,6-Dimethyl-4-pyridinol;2,6-Dimethyl-4-hydroxypyridine ,98%;2,6-Dimethylpyridine-4-ol;2,6-Dimethylpyridin-4-ol, 4-Hydroxy-2,6-lutidine;4-HYDROXY-2,6-DIMETHYLPYRIDINE | | CAS: | 13603-44-6 | | MF: | C7H9NO | | MW: | 123.15 | | EINECS: | 237-089-2 | | Product Categories: | Heterocycle-Pyridine series;Heterocyclic Building Blocks;pharmacetical;Pyridine;Pyridines derivates;Heterocyclic Compounds;Pyridines | | Mol File: | 13603-44-6.mol |  |
| | 4-Hydroxy-2,6-dimethylpyridine Chemical Properties |
| Melting point | 230-232°C | | Boiling point | 351 °C | | density | 1,053g/cm | | refractive index | 1,501-1,503 | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly, Heated), Methanol (Slightly) | | form | Solid | | pka | 5.49±0.23(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C7H9NO/c1-5-3-7(9)4-6(2)8-5/h3-4H,1-2H3,(H,8,9) | | InChIKey | PRAFLUMTYHBEHE-UHFFFAOYSA-N | | SMILES | C1(C)=NC(C)=CC(O)=C1 | | LogP | 0.190 (est) | | CAS DataBase Reference | 13603-44-6(CAS DataBase Reference) |
| | 4-Hydroxy-2,6-dimethylpyridine Usage And Synthesis |
| Chemical Properties | Yellow to Brown Cryst | | Uses | 2,6-Dimethyl-4-hydroxypyridine is a useful synthetic intermediate. It is used in the synthesis of disubstituted pyridinyl-aminohydantoins as selective human BACE1 inhibitors. | | Synthesis | The general procedure for the synthesis of 2,6-dimethyl-4-hydroxypyridine from dehydroacetic acid was as follows: five different batches of dehydroacetic acid (1.5 g, 8.92 mmol) were suspended in concentrated ammonia (4 mL) and placed in a microwave reactor (Discover system, 150 W, CEM Corporation, Matthews, North Carolina, USA) and microwave irradiated at 120°C for 20 min. Upon completion of the reaction, the reaction mixture was cooled and all batches were combined and subsequently evaporated to dryness to afford the target product 2,6-dimethyl-4-hydroxypyridine. The mass of the product was 5.91 g (108% yield), which was analyzed by LC/MS showing a purity of 73%. Unreacted dehydroacetic acid was present as a residual mass balance.The LC/MS retention time was 0.67 min and the mass spectrum (ES+) showed m/z 168 (M + CH3CN + H). | | References | [1] Patent: WO2008/57497, 2008, A2. Location in patent: Page/Page column 252-253
[2] Patent: WO2008/57469, 2008, A1. Location in patent: Page/Page column 252-253
[3] Patent: WO2008/57468, 2008, A1. Location in patent: Page/Page column 252-253
[4] Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1988, vol. 42, # 6, p. 373 - 377
[5] Chemische Berichte, 1887, vol. 20, p. 159 |
| | 4-Hydroxy-2,6-dimethylpyridine Preparation Products And Raw materials |
|