|
|
| | 5-Chloro-2,3,3-trimethyl-3H-indole Basic information |
| Product Name: | 5-Chloro-2,3,3-trimethyl-3H-indole | | Synonyms: | AURORA KA-3417;5-CHLORO-1,3,3-TRIMETHYL-2-METHYLENEINDOLINE;5-CHLORO-2,3-DIHYDRO-1,3,3-TRIMETHYL-2-METHYLENE-1H-INDOLE;5-CHLORO-2,3,3-TRIMETHYL-3H-INDOLE;5-CHLORO-2,3,3-TRIMETHYLINDOLE;5-CHLORO-2,3,3-TRIMETHYL-INDOLENINE;5-CHLORO-2,3,3-TRIMETHYLINDOLINE;2,3,3-TRIMETHYL-5-CHLORO-3H-INDOLE | | CAS: | 25981-83-3 | | MF: | C11H12ClN | | MW: | 193.67 | | EINECS: | 247-387-4 | | Product Categories: | Heterocyclic Acids;Heterocycle-Indole series;Halides;Pyrroles & Indoles;Indole;Pyrroles & Indoles | | Mol File: | 25981-83-3.mol |  |
| | 5-Chloro-2,3,3-trimethyl-3H-indole Chemical Properties |
| Boiling point | 271.1±40.0 °C(Predicted) | | density | 1.083 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.594(lit.) | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 4.87±0.40(Predicted) | | form | solid | | color | Red | | InChI | InChI=1S/C11H12ClN/c1-7-11(2,3)9-6-8(12)4-5-10(9)13-7/h4-6H,1-3H3 | | InChIKey | GSKATGIMEUGNJN-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(Cl)C=C2)C(C)(C)C=1C | | CAS DataBase Reference | 25981-83-3(CAS DataBase Reference) | | EPA Substance Registry System | 3H-Indole, 5-chloro-2,3,3-trimethyl- (25981-83-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2933998090 |
| | 5-Chloro-2,3,3-trimethyl-3H-indole Usage And Synthesis |
| | 5-Chloro-2,3,3-trimethyl-3H-indole Preparation Products And Raw materials |
|