- N-Phenylphthalimide
-
- $0.00 / 25kgs/paper bag
-
2026-02-15
- CAS:520-03-6
- Min. Order: 25kgs/paper bag
- Purity: 98%
- Supply Ability: 50 tons
- N-PHENYLPHTHALIMIDE
-
- $7.00 / 1g
-
2019-09-17
- CAS:520-03-6
- Min. Order: 1g
- Purity: 99%
- Supply Ability: JD 01
|
| | N-PHENYLPHTHALIMIDE Basic information |
| | N-PHENYLPHTHALIMIDE Chemical Properties |
| Melting point | 204-207 °C(lit.) | | Boiling point | 364.52°C (rough estimate) | | density | 1.1814 (rough estimate) | | refractive index | 1.4700 (estimate) | | storage temp. | 2-8°C | | pka | -0.54±0.20(Predicted) | | form | powder | | Appearance | White to off-white Solid | | InChI | 1S/C14H9NO2/c16-13-11-8-4-5-9-12(11)14(17)15(13)10-6-2-1-3-7-10/h1-9H | | InChIKey | MFUPLJQNEXUUDW-UHFFFAOYSA-N | | SMILES | O=C1N(c2ccccc2)C(=O)c3ccccc13 | | CAS DataBase Reference | 520-03-6(CAS DataBase Reference) | | EPA Substance Registry System | 1H-Isoindole-1,3(2H)-dione, 2-phenyl- (520-03-6) |
| WGK Germany | 3 | | RTECS | TI5635800 | | TSCA | TSCA listed | | Storage Class | 13 - Non Combustible Solids |
| | N-PHENYLPHTHALIMIDE Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Synthesis Reference(s) | The Journal of Organic Chemistry, 24, p. 388, 1959 DOI: 10.1021/jo01085a030 |
| | N-PHENYLPHTHALIMIDE Preparation Products And Raw materials |
|