|
|
| | THYMOL IODIDE Basic information |
| Product Name: | THYMOL IODIDE | | Synonyms: | P-CYMEN-3-OL IODIDE;THYMOL IODIDE;THYME CAMPHOR IODIDE;annidalin;bithymoldiiodide;Hypoiodous acid, 2,2-dimethyl-5,5-bis(1-methylethyl)1,1-biphenyl-4,4-diyl ester;THYMOLIODIDE,POWDER,PURIFIED;5,5'-diisopropyl-2,2'-diMethyl-[1,1'-biphenyl]-4,4'-diyl dihypoiodite | | CAS: | 552-22-7 | | MF: | C20H24I2O2 | | MW: | 550.22 | | EINECS: | 209-007-5 | | Product Categories: | Organics | | Mol File: | 552-22-7.mol |  |
| | THYMOL IODIDE Chemical Properties |
| Boiling point | 479.0±55.0 °C(Predicted) | | density | 1.617±0.06 g/cm3(Predicted) | | vapor pressure | 0.014Pa at 20℃ | | storage temp. | 2-8°C | | solubility | DMSO: < 1 mg/mL (insoluble or slightly soluble) | | form | Solid | | color | Light yellow to yellow | | Stability: | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | InChI=1S/C20H24I2O2/c1-11(2)15-9-17(13(5)7-19(15)23-21)18-10-16(12(3)4)20(24-22)8-14(18)6/h7-12H,1-6H3 | | InChIKey | SHOKWSLXDAIZPP-UHFFFAOYSA-N | | SMILES | CC1=CC(OI)=C(C(C)C)C=C1C1C(=CC(OI)=C(C(C)C)C=1)C | | LogP | 8.573 (est) | | CAS DataBase Reference | 552-22-7(CAS DataBase Reference) | | EPA Substance Registry System | Thymol iodide (552-22-7) |
| | THYMOL IODIDE Usage And Synthesis |
| Chemical Properties | reddish-brown or yellow crystalline powder | | Uses | Feed additive, antifungal agent. | | Uses | Thymol iodide is a dithymol diiodide compound. | | Flammability and Explosibility | Not classified | | Biological Activity | Iodinated thymol with mild antiseptic activity |
| | THYMOL IODIDE Preparation Products And Raw materials |
|