| Company Name: |
Varanous Labs Pvt Ltd
|
| Tel: |
+91-7036248882 |
| Email: |
bheemashankar.e@varanouslabs.com |
| Products Intro: |
Product Name:Carbidopa Impurity F
CAS:1458640-32-8
Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
|
| | Carbidopa impurity F Basic information |
| Product Name: | Carbidopa impurity F | | Synonyms: | ethyl (2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoate;Carbidopa impurity F;(αS)-α-Hydrazinyl-3,4-dihydroxy-α-methylbenzenepropanoic Acid Ethyl Ester;Benzenepropanoic acid, α-hydrazinyl-3,4-dihydroxy-α-methyl-, ethyl ester, (αS)-;-Hydrazinyl-3,4-dihydroxy-α-methylbenzenepropanoicAcidEthylEster;Carbidopa EP Impurity FQ: What is
Carbidopa EP Impurity F Q: What is the CAS Number of
Carbidopa EP Impurity F Q: What is the storage condition of
Carbidopa EP Impurity F Q: What are the applications of
Carbidopa EP Impurity F;Carbidopa Impurity 6 | | CAS: | 1458640-32-8 | | MF: | C12H18N2O4 | | MW: | 254.29 | | EINECS: | | | Product Categories: | | | Mol File: | 1458640-32-8.mol |  |
| | Carbidopa impurity F Chemical Properties |
| Melting point | >169°C (dec.) | | Boiling point | 487.2±45.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 9.82±0.10(Predicted) | | color | Light Grey to Grey | | Stability: | Hygroscopic | | InChI | InChI=1/C12H18N2O4/c1-3-18-11(17)12(2,14-13)7-8-4-5-9(15)10(16)6-8/h4-6,14-16H,3,7,13H2,1-2H3/t12-/s3 | | InChIKey | IVYOMTNVXXPNCD-PLAQIDKDNA-N | | SMILES | [C@](C)(NN)(CC1C=CC(O)=C(O)C=1)C(=O)OCC |&1:0,r| |
| | Carbidopa impurity F Usage And Synthesis |
| Uses | (αS)-α-Hydrazinyl-3,4-dihydroxy-α-methylbenzenepropanoic Acid Ethyl Ester is an potential dopa ester decarboxylase inhibitors for treating neurological or movement diseases or disorders. |
| | Carbidopa impurity F Preparation Products And Raw materials |
|