|
|
| | Androst-5-en-3-ol-7,17-dione acetate Basic information |
| Product Name: | Androst-5-en-3-ol-7,17-dione acetate | | Synonyms: | 10,13-dimethyl-7,17-dioxo-2,3,4,8,9,11,12,14,15,16-decahydro-1h-cyclopenta[a]phenanthren-3-yl acetate;Androst-5-ene-7,17-dione,3beta-acetyloxy;7-OXO-DHA;Androst-5-en-7,17-dione,3b-acetyloxy;5-Androsten-3--ol-7,17-dioneacetate;7-KETO-DHEA;3-ACEDYL-7-KETO-DHEA;7-OXO-DEHYDROEPIANDROSTERONE ACETATE 99% | | CAS: | 1449-61-2 | | MF: | C21H28O4 | | MW: | 344.44 | | EINECS: | 683-490-4 | | Product Categories: | Pharmaceutical Raw Materials;steroids | | Mol File: | 1449-61-2.mol |  |
| | Androst-5-en-3-ol-7,17-dione acetate Chemical Properties |
| Melting point | 184.5-187.5 °C | | Boiling point | 479.6±45.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1/C21H28O4/c1-12(22)25-14-6-8-20(2)13(10-14)11-17(23)19-15-4-5-18(24)21(15,3)9-7-16(19)20/h11,14-16,19H,4-10H2,1-3H3/t14-,15-,16-,19-,20-,21-/s3 | | InChIKey | VVSMJVQHDZUPIL-XHRCOXFGNA-N | | SMILES | [C@@]12([H])C(=O)C=C3C[C@@H](OC(=O)C)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(CC[C@@]21[H])=O |&1:0,7,14,16,20,25,r| | | CAS DataBase Reference | 1449-61-2(CAS DataBase Reference) |
| | Androst-5-en-3-ol-7,17-dione acetate Usage And Synthesis |
| Chemical Properties | White to off-white crystalline powder | | Uses | 7-Keto Naturalean is a reactant used in the synthesis of C19-steroidal androgen receptor modulators for potential treatment of prostate cancer. |
| | Androst-5-en-3-ol-7,17-dione acetate Preparation Products And Raw materials |
|