- TRIPENTAERYTHRITOL
-
- $1.00 / 1KG
-
2020-01-10
- CAS:78-24-0
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 tons/month
|
| | TRIPENTAERYTHRITOL Basic information |
| Product Name: | TRIPENTAERYTHRITOL | | Synonyms: | TRIPENTAERYTHRITOL;2,2-bis[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-3-propanediol;3-Propanediol,2,2-bis[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-1;4,8-dioxa-2,2,6,6,10,10-hexahydroxymethylundecane-1,11-diol;TRIPENTAERYTHRITOL, TECH.;Tripentaerythritol, hydroxyl content min. 35%, tech.;Tripentaerythrite;1,3-Propanediol, 2,2-bis3-hydroxy-2,2-bis(hydroxymethyl)propoxymethyl- | | CAS: | 78-24-0 | | MF: | C15H32O10 | | MW: | 372.41 | | EINECS: | 201-097-4 | | Product Categories: | Organic Building Blocks;Oxygen Compounds;Polyols | | Mol File: | 78-24-0.mol |  |
| | TRIPENTAERYTHRITOL Chemical Properties |
| Melting point | 225 °C (dec.) (lit.) | | Boiling point | 421.87°C (rough estimate) | | density | 1.2442 (rough estimate) | | refractive index | 1.5376 (estimate) | | pka | 13.38±0.10(Predicted) | | form | solid | | InChI | InChI=1S/C15H32O10/c16-1-13(2-17,3-18)9-24-11-15(7-22,8-23)12-25-10-14(4-19,5-20)6-21/h16-23H,1-12H2 | | InChIKey | PTJWCLYPVFJWMP-UHFFFAOYSA-N | | SMILES | C(O)C(COCC(CO)(CO)CO)(COCC(CO)(CO)CO)CO | | EPA Substance Registry System | 1,3-Propanediol, 2,2-bis[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]- (78-24-0) |
| Safety Statements | 24/25 | | WGK Germany | 3 |
| | TRIPENTAERYTHRITOL Usage And Synthesis |
| Description | Tripentaerythritol, 2,2-bis{[hydroxy- 2,2-bis(hydroxymethyl)propoxy]methyl}-1,3- propanediol, is only slightly soluble in water and can be isolated during the production of dipentaerythritol. It has at present only a very limited economic importance. It is possibly suitable for the same applications as dipentaerythritol.
| | Chemical Properties | White to ivory powder; has eight primary
hydroxyl groups, all esterifiable. Combustible. | | Uses | Hard resins, varnishes, and fast-drying tall-oil
vehicles. |
| | TRIPENTAERYTHRITOL Preparation Products And Raw materials |
|