|
| 3-Fluoro-5-nitrotoluene Basic information |
| 3-Fluoro-5-nitrotoluene Chemical Properties |
Melting point | 40.0-40.5 °C(Solv: water (7732-18-5); methanol (67-56-1)) | Boiling point | 230.0±20.0 °C(Predicted) | density | 1.274±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | form | Crystalline Solid | color | Yellow | InChI | InChI=1S/C7H6FNO2/c1-5-2-6(8)4-7(3-5)9(10)11/h2-4H,1H3 | InChIKey | IPMURRZVEWZEPP-UHFFFAOYSA-N | SMILES | C1(F)=CC([N+]([O-])=O)=CC(C)=C1 | CAS DataBase Reference | 499-08-1(CAS DataBase Reference) |
| 3-Fluoro-5-nitrotoluene Usage And Synthesis |
Chemical Properties | Pale yellow crystals | Uses | 3-Fluoro-5-nitrotoluene is mainly used as an intermediate in the pharmaceutical, chemical and material industries, especially in the synthesis of certain drugs and pesticide products. |
| 3-Fluoro-5-nitrotoluene Preparation Products And Raw materials |
|