|
|
| | 3-Methoxy-4-methylbenzoic acid Basic information |
| | 3-Methoxy-4-methylbenzoic acid Chemical Properties |
| Melting point | 152-154 °C (lit.) | | Boiling point | 168-170 °C(Press: 11 Torr) | | density | 1.168±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.25±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 1938389 | | InChI | InChI=1S/C9H10O3/c1-6-3-4-7(9(10)11)5-8(6)12-2/h3-5H,1-2H3,(H,10,11) | | InChIKey | CEAVPXDEPGAVDA-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(C)C(OC)=C1 | | CAS DataBase Reference | 7151-68-0(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoic acid, 3-methoxy-4-methyl-(7151-68-0) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids |
| | 3-Methoxy-4-methylbenzoic acid Usage And Synthesis |
| Chemical Properties | slightly yellow fine powder | | Uses | 3-Methoxy-4-methylbenzoic Acid is used in the preparation of acyl pentapetide lactone in actinomycin-prodcing streptoycetes. |
| | 3-Methoxy-4-methylbenzoic acid Preparation Products And Raw materials |
|