|
|
| | 4-(Methylamino)benzoic acid Basic information |
| | 4-(Methylamino)benzoic acid Chemical Properties |
| Melting point | 160-162 °C (lit.) | | Boiling point | 273.17°C (rough estimate) | | density | 1.2023 (rough estimate) | | refractive index | 1.5810 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Slightly soluble. Soluble in alcohol. | | pka | 5.04(at 25℃) | | form | Solid | | color | Off-White to Dark Beige | | BRN | 2082805 | | InChI | InChI=1S/C8H9NO2/c1-9-7-4-2-6(3-5-7)8(10)11/h2-5,9H,1H3,(H,10,11) | | InChIKey | ZVIDMSBTYRSMAR-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(NC)C=C1 | | CAS DataBase Reference | 10541-83-0(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoic acid, 4-(methylamino)-(10541-83-0) | | EPA Substance Registry System | Benzoic acid, 4-(methylamino)- (10541-83-0) |
| | 4-(Methylamino)benzoic acid Usage And Synthesis |
| Description | 4-(Methylamino) benzoic acid is an important intermediate for production of pharmaceutical products, dyes, flavors and preservatives. | | Chemical Properties | white to beige powder | | Uses | 4-(Methylamino)benzoic acid important for the preparation of other pharmaceutical products, dyes, flavors, and preservatives. .For the preparation of medicines and other fine chemicals. | | Definition | ChEBI: N-Methyl-4-aminobenzoate is an aminobenzoic acid. | | reaction suitability | reaction type: solution phase peptide synthesis | | References | https://www.alfa.com/en/catalog/A12426/ |
| | 4-(Methylamino)benzoic acid Preparation Products And Raw materials |
|