| Company Name: |
Hefei Molake Biotechnology Co., Ltd. Gold
|
| Tel: |
0551-66336380 18956014586 |
| Email: |
983438788@qq.com |
| Products Intro: |
Product Name:Doxofylline Impurity 11
CAS:109403-76-1
Purity:99%+ Package:100mg/RMB 800;100mg1g
|
| Company Name: |
Nanjing XiZe Biotechnology CO., Ltd.
|
| Tel: |
025-66023220 0086-15250997978 |
| Email: |
1511893459@qq.com |
| Products Intro: |
Product Name:Doxofylline Impurity 11
CAS:109403-76-1
Purity:95% HPLC Package:10mg;25mg;50mg;100mg;250mg;500mg;1g
|
| Company Name: |
Shenzhen Botel Biotechnology Co. Ltd.
|
| Tel: |
13316949107 13316968096 |
| Email: |
1979313431@qq.com |
| Products Intro: |
Product Name:Doxofylline Impurity 11
CAS:109403-76-1
Purity:98% HPLC Package:10mg;25mg;50mg
|
|
| | Doxofylline Impurity 11 Basic information |
| Product Name: | Doxofylline Impurity 11 | | Synonyms: | Doxofylline Impurity 11;7,7'-methylenebis(1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione);1H-Purine-2,6-dione, 7,7'-methylenebis[3,7-dihydro-1,3-dimethyl-;Theophylline impurities819;Theophylline impurities818;7,7'-methylenebis(1,3-dimethyl-1H-purine-2,6(3H,7H)-dione) | | CAS: | 109403-76-1 | | MF: | C15H16N8O4 | | MW: | 372.34 | | EINECS: | | | Product Categories: | | | Mol File: | 109403-76-1.mol |  |
| | Doxofylline Impurity 11 Chemical Properties |
| Melting point | 325 °C | | Boiling point | 725.2±70.0 °C(Predicted) | | density | 1.69±0.1 g/cm3(Predicted) | | pka | 0.25±0.70(Predicted) | | InChI | InChI=1S/C15H16N8O4/c1-18-10-8(12(24)20(3)14(18)26)22(5-16-10)7-23-6-17-11-9(23)13(25)21(4)15(27)19(11)2/h5-6H,7H2,1-4H3 | | InChIKey | CAXWOQDAIYQFFX-UHFFFAOYSA-N | | SMILES | C(N1C2=C(N(C)C(=O)N(C)C2=O)N=C1)N1C2=C(N(C)C(=O)N(C)C2=O)N=C1 |
| | Doxofylline Impurity 11 Usage And Synthesis |
| | Doxofylline Impurity 11 Preparation Products And Raw materials |
|