|
|
| | 8-ethynyl-1,4-dioxaspiro[4.5]decane Basic information |
| Product Name: | 8-ethynyl-1,4-dioxaspiro[4.5]decane | | Synonyms: | 8-ethynyl-1,4-dioxaspiro[4.5]decane;1,4-Dioxaspiro[4.5]decane, 8-ethynyl-;Propanedioicacid,2-(2-propyn-4-yl)-,diethylester;8-ethynyl-1,4-dioxaspiro[4.5]decane - [E88095] | | CAS: | 96184-86-0 | | MF: | C10H14O2 | | MW: | 166.22 | | EINECS: | | | Product Categories: | 1 | | Mol File: | 96184-86-0.mol | ![8-ethynyl-1,4-dioxaspiro[4.5]decane Structure](CAS/20200331/GIF/96184-86-0.gif) |
| | 8-ethynyl-1,4-dioxaspiro[4.5]decane Chemical Properties |
| Boiling point | 233.5±40.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C10H14O2/c1-2-9-3-5-10(6-4-9)11-7-8-12-10/h1,9H,3-8H2 | | InChIKey | KLQRERRXSGHFPC-UHFFFAOYSA-N | | SMILES | O1C2(CCC(C#C)CC2)OCC1 |
| | 8-ethynyl-1,4-dioxaspiro[4.5]decane Usage And Synthesis |
| | 8-ethynyl-1,4-dioxaspiro[4.5]decane Preparation Products And Raw materials |
|