|
| 2'-(Oxiranylmethoxy)-3-phenylpropiophenon Basic information |
Product Name: | 2'-(Oxiranylmethoxy)-3-phenylpropiophenon | Synonyms: | Einecs 245-052-7;2-(2,3-Epoxypropoxy)-3-phenylpropylophenone;Propafenone IMp. C (EP);Propafenone IMpurity C (EP/BP/USP);1-[2-(oxiran-2-ylMethoxy)phenyl]-3-phenylpropan-1-one;Propafenone EP Impurity C;2'-(oxiranylmethoxy)-3-phenylpropiophenone;2-(2,3-EPOXYPROPOXY)-3-PHENYLPROPLOPHENONE 98.5+% | CAS: | 22525-95-7 | MF: | C18H18O3 | MW: | 282.33 | EINECS: | 245-052-7 | Product Categories: | Aromatics;Heterocycles | Mol File: | 22525-95-7.mol | |
| 2'-(Oxiranylmethoxy)-3-phenylpropiophenon Chemical Properties |
Melting point | 56-58°C | Boiling point | 452.8±25.0 °C(Predicted) | density | 1.164±0.06 g/cm3(Predicted) | storage temp. | Refrigerator | solubility | Chloroform (Sparingly), Ethyl Acetate, DMSO (Slightly) | form | Solid | color | White to Off-White | InChI | InChI=1S/C18H18O3/c19-17(11-10-14-6-2-1-3-7-14)16-8-4-5-9-18(16)21-13-15-12-20-15/h1-9,15H,10-13H2 | InChIKey | AUZMQKJKLUZHBY-UHFFFAOYSA-N | SMILES | C(C1=CC=CC=C1OCC1CO1)(=O)CCC1=CC=CC=C1 | CAS DataBase Reference | 22525-95-7(CAS DataBase Reference) |
| 2'-(Oxiranylmethoxy)-3-phenylpropiophenon Usage And Synthesis |
Chemical Properties | Pale-Yellow Solid | Uses | 2’-(2,3-Epoxypropoxy)-3-phenylpropiophenone (Propafenone EP Impurity C; Propafenone BP Impurity C; Propafenone USP Impurity C) is an impurity in the synthesis of propafenone (P757500). |
| 2'-(Oxiranylmethoxy)-3-phenylpropiophenon Preparation Products And Raw materials |
|