|
|
| | 4,6-DICHLORO-1H-INDOLE-2,3-DIONE Basic information |
| Product Name: | 4,6-DICHLORO-1H-INDOLE-2,3-DIONE | | Synonyms: | 4,6-DICHLORO-1H-INDOLE-2,3-DIONE 97.0%(MIN)(HPLC);4,6-Dichloroindoline-2,3-dione;4,6-DICHLORO-1H-INDO;4,6-dichloro-2,3-dihydro-1H-indole-2,3-dione;4,6- twoisatin chloride;4,6-Dichloroisatin, 95+%;4,6-Dichloroindole-2,3-dione;(3E)-3-[(4-propan-2-ylphenyl)methylidene]-2-pyrrolidinone | | CAS: | 18711-15-4 | | MF: | C8H3Cl2NO2 | | MW: | 216.02 | | EINECS: | | | Product Categories: | | | Mol File: | 18711-15-4.mol |  |
| | 4,6-DICHLORO-1H-INDOLE-2,3-DIONE Chemical Properties |
| Melting point | 260.5-261℃ | | density | 1.643±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Sealed in dry,Room Temperature | | pka | 8.59±0.20(Predicted) | | InChI | InChI=1S/C8H3Cl2NO2/c9-3-1-4(10)6-5(2-3)11-8(13)7(6)12/h1-2H,(H,11,12,13) | | InChIKey | CGCVHJCZBIYRQC-UHFFFAOYSA-N | | SMILES | N1C2=C(C(Cl)=CC(Cl)=C2)C(=O)C1=O |
| | 4,6-DICHLORO-1H-INDOLE-2,3-DIONE Usage And Synthesis |
| Chemical Properties | Yellow powder |
| | 4,6-DICHLORO-1H-INDOLE-2,3-DIONE Preparation Products And Raw materials |
|