Chemtrue-RL-N5 manufacturers
- Relugolix Impurity 1
-
- $0.00 / 10mg
-
2025-09-25
- CAS:1589503-97-8
- Min. Order: 10mg
- Purity: 98%
- Supply Ability: 500mg
|
| | Chemtrue-RL-N5 Basic information |
| Product Name: | Chemtrue-RL-N5 | | Synonyms: | Chemtrue-RL-N5;Relugolix intermediate4;ethyl 2-((2,6-difluorobenzyl)(ethoxycarbonyl)amino)-4-((dime...;Relugolix Impurity 68;Relugolix Impurity 33;Ethyl 2-[(2,6-difluorobenzyl)(ethoxycarbonyl)amino]-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)-3-thiophenecarboxylate;3-Thiophenecarboxylic acid, 2-[[(2,6-difluorophenyl)methyl](ethoxycarbonyl)amino]-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)-, ethyl ester;2-[(2,6-Difluorobenzyl)ethoxycarbonylamino]-4-((dimethylamino)methyl)-5-(4-nitrophenyl)thiophene-3-carboxylic acid ethyl ester | | CAS: | 1589503-97-8 | | MF: | C26H27F2N3O6S | | MW: | 547.57 | | EINECS: | 854-336-5 | | Product Categories: | | | Mol File: | 1589503-97-8.mol |  |
| | Chemtrue-RL-N5 Chemical Properties |
| Boiling point | 663.0±55.0 °C(Predicted) | | density | 1.333±0.06 g/cm3(Predicted) | | pka | 7.75±0.28(Predicted) | | InChIKey | RXZAFTDZUPTIRJ-UHFFFAOYSA-N | | SMILES | C1(N(CC2=C(F)C=CC=C2F)C(OCC)=O)SC(C2=CC=C([N+]([O-])=O)C=C2)=C(CN(C)C)C=1C(OCC)=O |
| | Chemtrue-RL-N5 Usage And Synthesis |
| Uses | Chemtrue-RL-N5 can be used as a pharmaceutical intermediate, primarily as Relugolix Impurity 5. |
| | Chemtrue-RL-N5 Preparation Products And Raw materials |
|