|
|
| | (R)-1-(2-Fluorophenyl)ethylamine Basic information |
| Product Name: | (R)-1-(2-Fluorophenyl)ethylamine | | Synonyms: | R-OF-PEM;(R)-1-(2-FLUOROPHENYL)ETHYLAMINE;(R)-1-(2-FLUOROPHENYL)ETHANAMINE;Benzenemethanamine, 2-fluoro-alpha-methyl-, (R)- (9CI);Benzenemethanamine, 2-fluoro-α-methyl-, (αR)-;(1R)-1-(2-Fluorophenyl)ethylamine;(1R)-1-(2-fluorophenyl)ethanamine;Benzenemethanamine,2-fluoro-a-methyl-, (aR)- | | CAS: | 185545-90-8 | | MF: | C8H10FN | | MW: | 139.17 | | EINECS: | | | Product Categories: | HALIDE | | Mol File: | 185545-90-8.mol |  |
| | (R)-1-(2-Fluorophenyl)ethylamine Chemical Properties |
| Boiling point | 179.8±15.0 °C(Predicted) | | density | 1.063±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 8.62±0.10(Predicted) | | form | liquid | | color | Clear | | InChI | InChI=1/C8H10FN/c1-6(10)7-4-2-3-5-8(7)9/h2-6H,10H2,1H3/t6-/s3 | | InChIKey | DIWHJJUFVGEXGS-ISZMHOAENA-N | | SMILES | C1([C@H](N)C)C=CC=CC=1F |&1:1,r| |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2921490090 |
| | (R)-1-(2-Fluorophenyl)ethylamine Usage And Synthesis |
| | (R)-1-(2-Fluorophenyl)ethylamine Preparation Products And Raw materials |
|