- 3-Aminophthalic acid
-
- $27.90 / 25Kg/Drum
-
2025-11-19
- CAS:5434-20-8
- Min. Order: 25Kg/Drum
- Purity: 98.00%HPLC
- Supply Ability: 10tons/month
- 3-Aminophthalic acid
-
- $2.00 / 100KG
-
2025-10-13
- CAS:5434-20-8
- Min. Order: 0.1KG
- Purity: 99%
- Supply Ability: g-kg-tons
- 3-AMINOPHTHALIC ACID
-
- $1.00 / 1KG
-
2019-07-06
- CAS:5434-20-8
- Min. Order: 1KG
- Purity: 95%
- Supply Ability: 200KG
|
| | 3-AMINOPHTHALIC ACID Basic information |
| | 3-AMINOPHTHALIC ACID Chemical Properties |
| Melting point | 180-185 °C(lit.) | | Boiling point | 436.4±40.0 °C(Predicted) | | density | 1.551±0.06 g/cm3(Predicted) | | solubility | soluble in Methanol | | pka | 3.41±0.10(Predicted) | | form | Crystalline Powder | | color | Yellow | | InChI | InChI=1S/C8H7NO4/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3H,9H2,(H,10,11)(H,12,13) | | InChIKey | WGLQHUKCXBXUDV-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=CC=CC(N)=C1C(O)=O | | CAS DataBase Reference | 5434-20-8(CAS DataBase Reference) | | EPA Substance Registry System | 3-Aminophthalic acid (5434-20-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29224985 |
| | 3-AMINOPHTHALIC ACID Usage And Synthesis |
| Chemical Properties | Yellow crystalline powder | | Uses | 3-Aminophthalic Acid is a reactant used in the preparation of local anesthetics. Also used as a precursor for a reagent in the synthesis of Apremilast (A729700). |
| | 3-AMINOPHTHALIC ACID Preparation Products And Raw materials |
|