- 3-Nitrobenzonitrile
-
- $139.66 / 1kg
-
2026-02-03
- CAS:619-24-9
- Min. Order: 1kg
- Purity: 98.0%min
- Supply Ability: 10tons/month
- 3-Nitrobenzonitrile
-
- $0.00 / 25kg
-
2025-12-01
- CAS:619-24-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- 3-Nitrobenzonitrile
-
- $9.00 / 1KG
-
2025-05-26
- CAS:619-24-9
- Min. Order: 1KG
- Purity: 99.9
- Supply Ability: 1 ton
|
| | 3-Nitrobenzonitrile Basic information |
| | 3-Nitrobenzonitrile Chemical Properties |
| Melting point | 114-117 °C(lit.) | | Boiling point | 165 °C (21 mmHg) | | density | 0.33 g/cm3 (20℃) | | refractive index | 1.5300 (estimate) | | Fp | 165°C/21mm | | storage temp. | Store below +30°C. | | solubility | very soluble in Ether | | form | Crystalline Powder or Needles | | color | Yellow | | BRN | 637674 | | InChI | InChI=1S/C7H4N2O2/c8-5-6-2-1-3-7(4-6)9(10)11/h1-4H | | InChIKey | RUSAWEHOGCWOPG-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=CC([N+]([O-])=O)=C1 | | CAS DataBase Reference | 619-24-9(CAS DataBase Reference) | | NIST Chemistry Reference | Benzonitrile, 3-nitro-(619-24-9) | | EPA Substance Registry System | Benzonitrile, 3-nitro- (619-24-9) |
| Hazard Codes | Xn,T,Xi | | Risk Statements | 20/22-20/21/22-23/24/25 | | Safety Statements | 22-24/25-36/37-45-36/37/39-26 | | RIDADR | UN 3439 6.1/PG 2 | | WGK Germany | 3 | | RTECS | DI4900000 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269095 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Nitrobenzonitrile Usage And Synthesis |
| Chemical Properties | YELLOWISH CRYSTALLINE POWDER OR NEEDLES | | Uses | 3-Nitrobenzonitrile is a compound useful in organic synthesis. | | Uses | 3-Nitrobenzonitrile (cas# 619-24-9) is a compound useful in organic synthesis. | | Application | 3-Nitrobenzonitrile was employed as matrix for matrix assisted ionization vacuum method for mass spectrometery. |
| | 3-Nitrobenzonitrile Preparation Products And Raw materials |
|