|
|
| | 4-NITROBENZO-18-CROWN-6 Basic information |
| Product Name: | 4-NITROBENZO-18-CROWN-6 | | Synonyms: | 4'-NITROBENZO-18-CROWN-6;4-NITROBENZO-18-CROWN-6;4'-NITROBENZO-18-CROWN 6-ETHER;2,3-(4-NITROBENZO)-1,4,7,10,13,16-HEXAOXACYCLOOCTADEC-2-ENE;NITROBENZO-18-CROWN-6;4-Nitrobenzo-18-crown-6,99%;NITROBENZO-18-CROWN-6, 99+%;1,16-(4-Nitro-1,2-phenylene)-1,4,7,10,13,16-hexaoxahexadecane | | CAS: | 53408-96-1 | | MF: | C16H23NO8 | | MW: | 357.36 | | EINECS: | | | Product Categories: | Crown Ethers;Functional Materials;Macrocycles for Host-Guest Chemistry;Chelation/Complexation Compounds;Crown Ethers;Synthetic Reagents | | Mol File: | 53408-96-1.mol |  |
| | 4-NITROBENZO-18-CROWN-6 Chemical Properties |
| Melting point | 82-86 °C | | Boiling point | 453.11°C (rough estimate) | | density | 1.163 | | refractive index | 1.5230 (estimate) | | form | powder to crystal | | color | White to Yellow | | InChI | InChI=1S/C16H23NO8/c18-17(19)14-1-2-15-16(13-14)25-12-10-23-8-6-21-4-3-20-5-7-22-9-11-24-15/h1-2,13H,3-12H2 | | InChIKey | LQXOKBZWNFJJGI-UHFFFAOYSA-N | | SMILES | O1C2=CC=C([N+]([O-])=O)C=C2OCCOCCOCCOCCOCC1 | | CAS DataBase Reference | 53408-96-1(CAS DataBase Reference) |
| | 4-NITROBENZO-18-CROWN-6 Usage And Synthesis |
| Chemical Properties | LIGHT YELLOW FLUFFY POWDER | | Purification Methods | If impure and discoloured, then chromatograph it through Al2O3 and elute with *C6H6/hexane (1:1) containing 1% MeOH. The fractions are followed by TLC on Al2O3 (with Dragendorff's reagent for detection: RF 0.6 in the above solvent system). Recrystallise the residues from the required fractions from *C6H6/hexane to give yellowish leaflets. It complexes with Na or K ions with logKNa 3.95 and logKK 4.71. [Petranek & Ryba Collect Chem Czech Chem Commun 39 2033 1974.] |
| | 4-NITROBENZO-18-CROWN-6 Preparation Products And Raw materials |
|