- (2S)-3-Chlorpropan-1,2-diol
-
- $9.00 / 1KG
-
2025-09-25
- CAS:60827-45-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | (S)-(+)-3-Chloro-1,2-propanediol Basic information |
| | (S)-(+)-3-Chloro-1,2-propanediol Chemical Properties |
| Boiling point | 213 °C(lit.) | | density | 1.322 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.480(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | Water Solubility | Completely miscible in water | | form | clear liquid | | pka | 13.28±0.20(Predicted) | | color | very deep yellow | | BRN | 2202929 | | InChI | InChI=1S/C3H7ClO2/c4-1-3(6)2-5/h3,5-6H,1-2H2/t3-/m1/s1 | | InChIKey | SSZWWUDQMAHNAQ-GSVOUGTGSA-N | | SMILES | C(O)[C@H](O)CCl | | CAS DataBase Reference | 60827-45-4(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 21-25-41-68-62-36/37/38-23/25 | | Safety Statements | 26-28-39-45-36/37/39 | | RIDADR | UN 2689 6.1/PG 3 | | WGK Germany | 3 | | RTECS | TY4202300 | | F | 3-10 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29055900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Eye Dam. 1 |
| | (S)-(+)-3-Chloro-1,2-propanediol Usage And Synthesis |
| Chemical Properties | clear yellow to orange-yellow liquid | | Uses | (S)-3-Chloro-1,2-propanediol is a reagent used for the synthesis of S1P receptor 1 agonist ACT-334441. It is also used to synthesize and characterize chiral PEDOT enantiomers. |
| | (S)-(+)-3-Chloro-1,2-propanediol Preparation Products And Raw materials |
|