- chloramine B
-
- $0.00 / 25Kg/Drum
-
2025-11-11
- CAS:127-52-6
- Min. Order: 1T
- Purity: 995
- Supply Ability: 5000mt
- Chloramine B
-
- $10.00 / 1KG
-
2025-11-10
- CAS:127-52-6
- Min. Order: 100KG
- Purity: 99%
- Supply Ability: 100 mt
|
| | Chloramine B Basic information |
| | Chloramine B Chemical Properties |
| Melting point | 190°C | | Boiling point | 189℃[at 101 325 Pa] | | density | 1.484[at 20℃] | | vapor pressure | 0Pa at 20℃ | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | H2O: 0.1 g/mL, clear | | pka | 1.88[at 20 ℃] | | form | solid | | Appearance | White to off-white Solid | | Water Solubility | 0.1 g/mL | | Merck | 14,2074 | | BRN | 3599287 | | InChI | InChI=1S/C6H5ClNO2S.Na/c7-8-11(9,10)6-4-2-1-3-5-6;/h1-5H;/q-1;+1 | | InChIKey | KDNCILYKSYKEFJ-UHFFFAOYSA-N | | SMILES | C1(=CC=CC=C1)S(=O)(=O)N(Cl)[Na] | | LogP | 0.14 at 26℃ | | EPA Substance Registry System | Chloramine B (127-52-6) |
| | Chloramine B Usage And Synthesis |
| Uses | It's a organochlorine disinfectant, and the effective chloric arrive 26-28%, the property is stable, only loss 0.1% effective chloric after airtight kept 1 year . Slightly soluble in water, and Stimulating & corrosive is small, so the efficacy is slower than hypochlorous acid. Chloramine-B is mainly used for disinfecting container of drinking water, all kind of tableware, fruits and vegetables(5ppm), aquaculture water and enamel instruments(1%). It's also can be used for cleaning breast of cattle, milk cup, livestock urinary tract, festering,etc. | | Uses | Used in investigations of the toxicity response of electroactive microbial biofilms
Catalyst for rearrangement of aziridinofullerenes to azafulleroids
Oxidizing agent for polymerization of thiophenol, synthesis of o-aminobenzenesulfonic acids and ciproflaxin
Decontaminant for mustard | | Flammability and Explosibility | Non flammable | | reaction suitability | reagent type: oxidant |
| | Chloramine B Preparation Products And Raw materials |
|