- Benzylmalonic acid
-
- $1.00 / 1KG
-
2019-07-14
- CAS:616-75-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1ton
|
| | Benzylmalonic acid Basic information |
| | Benzylmalonic acid Chemical Properties |
| Melting point | 117-120 °C (lit.) | | Boiling point | 290.62°C (rough estimate) | | density | 1.2534 (rough estimate) | | refractive index | 1.5430 (estimate) | | storage temp. | Refrigerator | | solubility | Chloroform, DMSO, Ethyl Acetate, Methanol | | form | Solid | | pka | 3.18±0.10(Predicted) | | color | Pale Yellow | | BRN | 643530 | | InChI | InChI=1S/C10H10O4/c11-9(12)8(10(13)14)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,11,12)(H,13,14) | | InChIKey | JAEJSNFTJMYIEF-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(CC1=CC=CC=C1)C(O)=O | | CAS DataBase Reference | 616-75-1(CAS DataBase Reference) | | NIST Chemistry Reference | Benzylmalonic acid(616-75-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | OO0525000 | | HS Code | 29173990 |
| | Benzylmalonic acid Usage And Synthesis |
| Chemical Properties | COLOURLESS TO WHITE CRYSTALS OR CRYSTALLINE POWDER | | Uses | Benzylmalonic acid is used in cosmetic compositions. | | Purification Methods | Crystallise the acid from *C6H6. [Beilstein 9 IV 3357.] |
| | Benzylmalonic acid Preparation Products And Raw materials |
|