|
|
| | 3-(Trifluoromethyl)benzaldehyde Basic information | | Uses |
| | 3-(Trifluoromethyl)benzaldehyde Chemical Properties |
| Boiling point | 83-86 °C30 mm Hg(lit.) | | density | 1.301 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.465(lit.) | | Fp | 155 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | color | Clear colorless to very slightly orange | | Specific Gravity | 1.301 | | Sensitive | Air Sensitive | | BRN | 2327537 | | InChI | 1S/C8H5F3O/c9-8(10,11)7-3-1-2-6(4-7)5-12/h1-5H | | InChIKey | NMTUHPSKJJYGML-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1cccc(c1)C(F)(F)F | | CAS DataBase Reference | 454-89-7(CAS DataBase Reference) | | NIST Chemistry Reference | Benzaldehyde, 3-(trifluoromethyl)-(454-89-7) | | EPA Substance Registry System | Benzaldehyde, 3-(trifluoromethyl)- (454-89-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN3082 - class 9 - PG 3 - DOT NA1993 - Environmentally hazardous substances, liquid, n.o.s. HI: all (not BR) | | WGK Germany | 3 | | F | 10-23 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29130000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 2
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-(Trifluoromethyl)benzaldehyde Usage And Synthesis |
| Uses | 3-(Trifluoromethyl)benzaldehyde is used as a reagent in the synthesis of 2,3-di- and 2,2,3-trisubstituted-3-methoxycarbonyl-γ-butyrolactones as potent antitumor agents. Also used as a reagent in the synthesis of novel chalcone derivatives as hypoxia-inducible factor (HIF)-1 inhibitors. | | Chemical Properties | CLEAR COLOURLESS TO VERY SLIGHTLY ORANGE LIQUID | | Uses | 3-(Trifluoromethyl)benzaldehyde is used as a reagent in the synthesis of 2,3-di- and 2,2,3-trisubstituted-3-methoxycarbonyl-╬│-butyrolactones as potent antitumor agents. Also used as a reagent in the synthesis of novel chalcone derivatives as hypoxia-inducible factor (HIF)-1 inhibitors. | | Synthesis Reference(s) | Journal of the American Chemical Society, 68, p. 426, 1946 DOI: 10.1021/ja01207a024 | | General Description | Aldol reaction of 3-(trifluoromethyl)benzaldehyde with hydroxyacetone in the aldolase antibody 38C2-ionic liquid system has been investigated. |
| | 3-(Trifluoromethyl)benzaldehyde Preparation Products And Raw materials |
|