|
|
| | 2-Bromobenzenesulphonyl chloride Basic information |
| | 2-Bromobenzenesulphonyl chloride Chemical Properties |
| Melting point | 49-52 °C (lit.) | | Boiling point | 98-100°C (0.5 torr) | | density | 1.7910 (estimate) | | Fp | 127-128°C/2.4mm | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Crystalline Powder | | color | Slightly yellow | | Sensitive | Moisture Sensitive | | BRN | 2692202 | | InChI | InChI=1S/C6H4BrClO2S/c7-5-3-1-2-4-6(5)11(8,9)10/h1-4H | | InChIKey | VFPWGZNNRSQPBT-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=CC=CC=C1Br | | CAS DataBase Reference | 2905-25-1(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Bromobenzenesulfonyl chloride(2905-25-1) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 |
| | 2-Bromobenzenesulphonyl chloride Usage And Synthesis |
| Chemical Properties | slightly yellow crystalline powder | | Uses | 2-Bromobenzenesulfonyl chloride may be used in the following:
- Preparation of 2-bromobenzenesulfonic acid phenyl ester.
- For the sufonylation during the synthesis of 2-bromobenzenesulfonamide.
- Synthesis of chiral 2-(p-toluenesulfinyl)benzenesulfonamide.
| | General Description | 2-Bromobenzenesulfonyl chloride can be synthesized from 2-aminobenzenesulfonic acid. |
| | 2-Bromobenzenesulphonyl chloride Preparation Products And Raw materials |
|